C19H23F3O4S2 — CID 145012995
2-[tert-butyl(diphenyl)-λ4-sulfanyl]oxyethyl trifluoromethanesulfonate (PubChem CID 145012995) has the molecular formula C19H23F3O4S2 and a molecular weight of 436.52 g/mol. Its IUPAC name is 2-[tert-butyl(diphenyl)-λ4-sulfanyl]oxyethyl trifluoromethanesulfonate.
| Compound Name | 2-[tert-butyl(diphenyl)-λ4-sulfanyl]oxyethyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 145012995 |
| Molecular Formula | C19H23F3O4S2 |
| Molecular Weight | 436.52 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 2-[tert-butyl(diphenyl)-λ4-sulfanyl]oxyethyl trifluoromethanesulfonate |
| SMILES | CC(C)(C)S(OCCOS(=O)(=O)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H23F3O4S2/c1-18(2,3)27(16-10-6-4-7-11-16,17-12-8-5-9-13-17)25-14-15-26-28(23,24)19(20,21)22/h4-13H,14-15H2,1-3H3 |
| InChIKey | VNJOAEUTKQPQSS-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.52 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|