C22H30N4O — CID 145015137
ethane;3-[1-(4-methylphenyl)piperidin-4-yl]-4,5-dihydro-1H-pyrido[3,2-d][1,3]diazepin-2-one (PubChem CID 145015137) has the molecular formula C22H30N4O and a molecular weight of 366.51 g/mol. Its IUPAC name is ethane;3-[1-(4-methylphenyl)piperidin-4-yl]-4,5-dihydro-1H-pyrido[3,2-d][1,3]diazepin-2-one.
| Compound Name | ethane;3-[1-(4-methylphenyl)piperidin-4-yl]-4,5-dihydro-1H-pyrido[3,2-d][1,3]diazepin-2-one |
|---|---|
| PubChem CID | 145015137 |
| Molecular Formula | C22H30N4O |
| Molecular Weight | 366.51 g/mol |
| Exact Mass | 366.24 |
| IUPAC Name | ethane;3-[1-(4-methylphenyl)piperidin-4-yl]-4,5-dihydro-1H-pyrido[3,2-d][1,3]diazepin-2-one |
| SMILES | CC.Cc1ccc(N2CCC(N3CCc4ncccc4NC3=O)CC2)cc1 |
| InChI | InChI=1S/C20H24N4O.C2H6/c1-15-4-6-16(7-5-15)23-12-8-17(9-13-23)24-14-10-18-19(22-20(24)25)3-2-11-21-18;1-2/h2-7,11,17H,8-10,12-14H2,1H3,(H,22,25);1-2H3 |
| InChIKey | XUDSKNIZHABQCH-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.51 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|