C13H26 — CID 145016611
1,3-bis(ethenyl)cyclohexane;ethane;methane (PubChem CID 145016611) has the molecular formula C13H26 and a molecular weight of 182.35 g/mol. Its IUPAC name is 1,3-bis(ethenyl)cyclohexane;ethane;methane.
| Compound Name | 1,3-bis(ethenyl)cyclohexane;ethane;methane |
|---|---|
| PubChem CID | 145016611 |
| Molecular Formula | C13H26 |
| Molecular Weight | 182.35 g/mol |
| Exact Mass | 182.20 |
| IUPAC Name | 1,3-bis(ethenyl)cyclohexane;ethane;methane |
| SMILES | C.C=CC1CCCC(C=C)C1.CC |
| InChI | InChI=1S/C10H16.C2H6.CH4/c1-3-9-6-5-7-10(4-2)8-9;1-2;/h3-4,9-10H,1-2,5-8H2;1-2H3;1H4 |
| InChIKey | ZWYSYZDSTJEAAV-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.35 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|