About copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)
copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) (PubChem CID 145017260) has the molecular formula C24H24CuN4
and a molecular weight of 432.03 g/mol. Its IUPAC name is copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine).
Molecular Properties
| Compound Name | copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) |
| PubChem CID | 145017260 |
| Molecular Formula | C24H24CuN4 |
| Molecular Weight | 432.03 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) |
| SMILES | Cc1cccc(-c2cccc(C)n2)n1.Cc1cccc(-c2cccc(C)n2)n1.[Cu] |
| InChI | InChI=1S/2C12H12N2.Cu/c2*1-9-5-3-7-11(13-9)12-8-4-6-10(2)14-12;/h2*3-8H,1-2H3; |
| InChIKey | IYNRNYXVZJNUCH-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.03 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)?
The IUPAC name of copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) (CID 145017260) is copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine).
What is the SMILES notation for copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)?
The canonical SMILES for copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) is Cc1cccc(-c2cccc(C)n2)n1.Cc1cccc(-c2cccc(C)n2)n1.[Cu].
What is the InChIKey of copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)?
The InChIKey is IYNRNYXVZJNUCH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H12N2.Cu/c2*1-9-5-3-7-11(13-9)12-8-4-6-10(2)14-12;/h2*3-8H,1-2H3;.
What are the key properties of copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine)?
copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) has a molecular weight of 432.03 g/mol, XLogP of 5.52, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;bis(2-methyl-6-(6-methyl-2-pyridinyl)pyridine) is sourced from PubChem (CID 145017260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).