C17H22FNO — CID 145018564
(3Z)-3-[3-(4-fluorophenoxy)propyl]-N,4-dimethylhexa-3,5-dien-2-imine (PubChem CID 145018564) has the molecular formula C17H22FNO and a molecular weight of 275.37 g/mol. Its IUPAC name is (3Z)-3-[3-(4-fluorophenoxy)propyl]-N,4-dimethylhexa-3,5-dien-2-imine.
| Compound Name | (3Z)-3-[3-(4-fluorophenoxy)propyl]-N,4-dimethylhexa-3,5-dien-2-imine |
|---|---|
| PubChem CID | 145018564 |
| Molecular Formula | C17H22FNO |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (3Z)-3-[3-(4-fluorophenoxy)propyl]-N,4-dimethylhexa-3,5-dien-2-imine |
| SMILES | C=C/C(C)=C(CCCOc1ccc(F)cc1)\C(C)=N\C |
| InChI | InChI=1S/C17H22FNO/c1-5-13(2)17(14(3)19-4)7-6-12-20-16-10-8-15(18)9-11-16/h5,8-11H,1,6-7,12H2,2-4H3/b17-13-,19-14+ |
| InChIKey | VLALLGVPQMALFG-QPOYRMPTSA-N |
| XLogP | 4.58 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|