C12H16BrN3S2 — CID 145019354
CID 145019354 (PubChem CID 145019354) has the molecular formula C12H16BrN3S2 and a molecular weight of 346.32 g/mol.
| Compound Name | CID 145019354 |
|---|---|
| PubChem CID | 145019354 |
| Molecular Formula | C12H16BrN3S2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 345.00 |
| IUPAC Name | — |
| SMILES | BrC1=CCC=c2nc(C3CCCN3)[nH]c2=C1.SS |
| InChI | InChI=1S/C12H14BrN3.H2S2/c13-8-3-1-4-9-11(7-8)16-12(15-9)10-5-2-6-14-10;1-2/h3-4,7,10,14H,1-2,5-6H2,(H,15,16);1-2H |
| InChIKey | KNMRDWAWLUOCQY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|