C15H28 — CID 145019486
(1E,4E)-7,7-diethyl-6-methylcycloocta-1,4-diene;ethane (PubChem CID 145019486) has the molecular formula C15H28 and a molecular weight of 208.39 g/mol. Its IUPAC name is (1E,4E)-7,7-diethyl-6-methylcycloocta-1,4-diene;ethane.
| Compound Name | (1E,4E)-7,7-diethyl-6-methylcycloocta-1,4-diene;ethane |
|---|---|
| PubChem CID | 145019486 |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.39 g/mol |
| Exact Mass | 208.22 |
| IUPAC Name | (1E,4E)-7,7-diethyl-6-methylcycloocta-1,4-diene;ethane |
| SMILES | CC.CCC1(CC)C/C=C\C/C=C\C1C |
| InChI | InChI=1S/C13H22.C2H6/c1-4-13(5-2)11-9-7-6-8-10-12(13)3;1-2/h7-10,12H,4-6,11H2,1-3H3;1-2H3/b9-7-,10-8-; |
| InChIKey | MVHMJCKQWPTLSO-RMMOYNDYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|