About (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene
(1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene (PubChem CID 143371902) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene.
Molecular Properties
| Compound Name | (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene |
| PubChem CID | 143371902 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene |
| SMILES | CCC1(C)C/C=C\C/C=C\CC1 |
| InChI | InChI=1S/C12H20/c1-3-12(2)10-8-6-4-5-7-9-11-12/h4,6-7,9H,3,5,8,10-11H2,1-2H3/b6-4-,9-7- |
| InChIKey | OMBRAOQFTXMYFW-PJPBHMPJSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene?
The IUPAC name of (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene (CID 143371902) is (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene.
What is the SMILES notation for (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene?
The canonical SMILES for (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene is CCC1(C)C/C=C\C/C=C\CC1.
What is the InChIKey of (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene?
The InChIKey is OMBRAOQFTXMYFW-PJPBHMPJSA-N. The full InChI is InChI=1S/C12H20/c1-3-12(2)10-8-6-4-5-7-9-11-12/h4,6-7,9H,3,5,8,10-11H2,1-2H3/b6-4-,9-7-.
What are the key properties of (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene?
(1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene has a molecular weight of 164.29 g/mol, XLogP of 4.09, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene is sourced from PubChem (CID 143371902), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).