C12H20 — CID 143371902
(1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene (PubChem CID 143371902) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene.
| Compound Name | (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene |
|---|---|
| PubChem CID | 143371902 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (1E,4E)-7-ethyl-7-methylcyclonona-1,4-diene |
| SMILES | CCC1(C)C/C=C\C/C=C\CC1 |
| InChI | InChI=1S/C12H20/c1-3-12(2)10-8-6-4-5-7-9-11-12/h4,6-7,9H,3,5,8,10-11H2,1-2H3/b6-4-,9-7- |
| InChIKey | OMBRAOQFTXMYFW-PJPBHMPJSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|