C17H26ClFN2 — CID 145020202
3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-(cyclohexylmethyl)pyrrolidin-2-amine (PubChem CID 145020202) has the molecular formula C17H26ClFN2 and a molecular weight of 312.86 g/mol. Its IUPAC name is 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-(cyclohexylmethyl)pyrrolidin-2-amine.
| Compound Name | 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-(cyclohexylmethyl)pyrrolidin-2-amine |
|---|---|
| PubChem CID | 145020202 |
| Molecular Formula | C17H26ClFN2 |
| Molecular Weight | 312.86 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | 3-[(1Z,3Z)-5-chloro-1-fluorohexa-1,3,5-trienyl]-1-(cyclohexylmethyl)pyrrolidin-2-amine |
| SMILES | C=C(Cl)/C=C\C=C(/F)C1CCN(CC2CCCCC2)C1N |
| InChI | InChI=1S/C17H26ClFN2/c1-13(18)6-5-9-16(19)15-10-11-21(17(15)20)12-14-7-3-2-4-8-14/h5-6,9,14-15,17H,1-4,7-8,10-12,20H2/b6-5-,16-9- |
| InChIKey | IPOYOWCWAGBGSY-JMWGHLCNSA-N |
| XLogP | 4.34 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.86 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|