C19H36N3+ — CID 162812272
1-(cyclohexylmethyl)-6-methyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydropyrrolo[2,3-b]quinolin-9-ium-4-amine (PubChem CID 162812272) has the molecular formula C19H36N3+ and a molecular weight of 306.52 g/mol. Its IUPAC name is 1-(cyclohexylmethyl)-6-methyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydropyrrolo[2,3-b]quinolin-9-ium-4-amine.
| Compound Name | 1-(cyclohexylmethyl)-6-methyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydropyrrolo[2,3-b]quinolin-9-ium-4-amine |
|---|---|
| PubChem CID | 162812272 |
| Molecular Formula | C19H36N3+ |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.29 |
| IUPAC Name | 1-(cyclohexylmethyl)-6-methyl-2,3,3a,4,4a,5,6,7,8,8a,9,9a-dodecahydropyrrolo[2,3-b]quinolin-9-ium-4-amine |
| SMILES | CC1CCC2[NH2+]C3C(CCN3CC3CCCCC3)C(N)C2C1 |
| InChI | InChI=1S/C19H35N3/c1-13-7-8-17-16(11-13)18(20)15-9-10-22(19(15)21-17)12-14-5-3-2-4-6-14/h13-19,21H,2-12,20H2,1H3/p+1 |
| InChIKey | HPUIRHQFFAYPKU-UHFFFAOYSA-O |
| XLogP | 1.92 |
| TPSA | 45.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |