C22H18F2N4O4S — CID 145020929
(15R)-5-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-7-hydroxy-13-oxa-3,10-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-4,7-diene-6,9-dione (PubChem CID 145020929) has the molecular formula C22H18F2N4O4S and a molecular weight of 472.47 g/mol. Its IUPAC name is (15R)-5-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-7-hydroxy-13-oxa-3,10-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-4,7-diene-6,9-dione.
| Compound Name | (15R)-5-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-7-hydroxy-13-oxa-3,10-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-4,7-diene-6,9-dione |
|---|---|
| PubChem CID | 145020929 |
| Molecular Formula | C22H18F2N4O4S |
| Molecular Weight | 472.47 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (15R)-5-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-7-hydroxy-13-oxa-3,10-diazatetracyclo[8.6.0.03,8.011,15]hexadeca-4,7-diene-6,9-dione |
| SMILES | O=C1c2c(O)c(=O)c(-c3nnc(Cc4ccc(F)cc4F)s3)cn2CC2C[C@H]3COCC3N12 |
| InChI | InChI=1S/C22H18F2N4O4S/c23-12-2-1-10(15(24)5-12)4-17-25-26-21(33-17)14-7-27-6-13-3-11-8-32-9-16(11)28(13)22(31)18(27)20(30)19(14)29/h1-2,5,7,11,13,16,30H,3-4,6,8-9H2/t11-,13?,16?/m0/s1 |
| InChIKey | CAJGYJDCFNHIQK-XOMBGVMMSA-N |
| XLogP | 2.18 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.47 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |