C22H18F2N4O3S — CID 130255376
(3S,4R,6S)-13-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-11-hydroxy-5-methyl-1,8-diazatetracyclo[8.4.0.03,8.04,6]tetradeca-10,13-diene-9,12-dione (PubChem CID 130255376) has the molecular formula C22H18F2N4O3S and a molecular weight of 456.47 g/mol. Its IUPAC name is (3S,4R,6S)-13-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-11-hydroxy-5-methyl-1,8-diazatetracyclo[8.4.0.03,8.04,6]tetradeca-10,13-diene-9,12-dione.
| Compound Name | (3S,4R,6S)-13-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-11-hydroxy-5-methyl-1,8-diazatetracyclo[8.4.0.03,8.04,6]tetradeca-10,13-diene-9,12-dione |
|---|---|
| PubChem CID | 130255376 |
| Molecular Formula | C22H18F2N4O3S |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.11 |
| IUPAC Name | (3S,4R,6S)-13-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-11-hydroxy-5-methyl-1,8-diazatetracyclo[8.4.0.03,8.04,6]tetradeca-10,13-diene-9,12-dione |
| SMILES | CC1[C@H]2[C@H]3Cn4cc(-c5nnc(Cc6ccc(F)cc6F)s5)c(=O)c(O)c4C(=O)N3C[C@@H]12 |
| InChI | InChI=1S/C22H18F2N4O3S/c1-9-12-7-28-15(17(9)12)8-27-6-13(19(29)20(30)18(27)22(28)31)21-26-25-16(32-21)4-10-2-3-11(23)5-14(10)24/h2-3,5-6,9,12,15,17,30H,4,7-8H2,1H3/t9?,12-,15+,17+/m0/s1 |
| InChIKey | JZPPKGUSUBSUSQ-ANABWWQNSA-N |
| XLogP | 2.66 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |