C22H20F2N4O3S — CID 155258916
(1R,10R)-4-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-6-hydroxy-10-methyl-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-5,8-dione (PubChem CID 155258916) has the molecular formula C22H20F2N4O3S and a molecular weight of 458.49 g/mol. Its IUPAC name is (1R,10R)-4-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-6-hydroxy-10-methyl-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-5,8-dione.
| Compound Name | (1R,10R)-4-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-6-hydroxy-10-methyl-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-5,8-dione |
|---|---|
| PubChem CID | 155258916 |
| Molecular Formula | C22H20F2N4O3S |
| Molecular Weight | 458.49 g/mol |
| Exact Mass | 458.12 |
| IUPAC Name | (1R,10R)-4-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-6-hydroxy-10-methyl-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-5,8-dione |
| SMILES | C[C@@H]1CCC[C@@H]2CN1C(=O)c1c(O)c(=O)c(-c3nnc(Cc4ccc(F)cc4F)s3)cn12 |
| InChI | InChI=1S/C22H20F2N4O3S/c1-11-3-2-4-14-9-27(11)22(31)18-20(30)19(29)15(10-28(14)18)21-26-25-17(32-21)7-12-5-6-13(23)8-16(12)24/h5-6,8,10-11,14,30H,2-4,7,9H2,1H3/t11-,14-/m1/s1 |
| InChIKey | HBGHKPPMARYHNN-BXUZGUMPSA-N |
| XLogP | 3.51 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.49 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |