C25H26F2N4O5S — CID 69086776
(4R)-2-cyclobutyl-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-4-(2-methoxyethoxymethyl)-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 69086776) has the molecular formula C25H26F2N4O5S and a molecular weight of 532.57 g/mol. Its IUPAC name is (4R)-2-cyclobutyl-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-4-(2-methoxyethoxymethyl)-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | (4R)-2-cyclobutyl-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-4-(2-methoxyethoxymethyl)-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 69086776 |
| Molecular Formula | C25H26F2N4O5S |
| Molecular Weight | 532.57 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | (4R)-2-cyclobutyl-7-[5-[(2,4-difluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-4-(2-methoxyethoxymethyl)-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | COCCOC[C@H]1CN(C2CCC2)C(=O)c2c(O)c(=O)c(-c3nnc(Cc4ccc(F)cc4F)s3)cn21 |
| InChI | InChI=1S/C25H26F2N4O5S/c1-35-7-8-36-13-17-11-31(16-3-2-4-16)25(34)21-23(33)22(32)18(12-30(17)21)24-29-28-20(37-24)9-14-5-6-15(26)10-19(14)27/h5-6,10,12,16-17,33H,2-4,7-9,11,13H2,1H3/t17-/m1/s1 |
| InChIKey | AVWPRSBBGBYKHQ-QGZVFWFLSA-N |
| XLogP | 3.15 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.57 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|