C24H27FN4O5S — CID 69086679
(3R)-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-3-(2-methoxyethoxymethyl)-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 69086679) has the molecular formula C24H27FN4O5S and a molecular weight of 502.57 g/mol. Its IUPAC name is (3R)-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-3-(2-methoxyethoxymethyl)-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | (3R)-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-3-(2-methoxyethoxymethyl)-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 69086679 |
| Molecular Formula | C24H27FN4O5S |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | (3R)-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-3-(2-methoxyethoxymethyl)-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | COCCOC[C@H]1Cn2cc(-c3nnc(Cc4ccc(F)cc4)s3)c(=O)c(O)c2C(=O)N1C(C)C |
| InChI | InChI=1S/C24H27FN4O5S/c1-14(2)29-17(13-34-9-8-33-3)11-28-12-18(21(30)22(31)20(28)24(29)32)23-27-26-19(35-23)10-15-4-6-16(25)7-5-15/h4-7,12,14,17,31H,8-11,13H2,1-3H3/t17-/m1/s1 |
| InChIKey | JKHBFFMHBXKNSZ-QGZVFWFLSA-N |
| XLogP | 2.70 |
| TPSA | 106.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|