C24H27FN4O3S — CID 69086877
(4S)-4-tert-butyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione (PubChem CID 69086877) has the molecular formula C24H27FN4O3S and a molecular weight of 470.57 g/mol. Its IUPAC name is (4S)-4-tert-butyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione.
| Compound Name | (4S)-4-tert-butyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
|---|---|
| PubChem CID | 69086877 |
| Molecular Formula | C24H27FN4O3S |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.18 |
| IUPAC Name | (4S)-4-tert-butyl-7-[5-[(4-fluorophenyl)methyl]-1,3,4-thiadiazol-2-yl]-9-hydroxy-2-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-1,8-dione |
| SMILES | CC(C)N1C[C@H](C(C)(C)C)n2cc(-c3nnc(Cc4ccc(F)cc4)s3)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C24H27FN4O3S/c1-13(2)28-12-17(24(3,4)5)29-11-16(20(30)21(31)19(29)23(28)32)22-27-26-18(33-22)10-14-6-8-15(25)9-7-14/h6-9,11,13,17,31H,10,12H2,1-5H3/t17-/m1/s1 |
| InChIKey | FUCJZOSGCMOBBY-QGZVFWFLSA-N |
| XLogP | 4.25 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |