C15H29NO — CID 145021226
(E)-N-[(Z)-2,8-dimethylnon-4-en-4-yl]oxy-2-methylpropan-1-imine (PubChem CID 145021226) has the molecular formula C15H29NO and a molecular weight of 239.40 g/mol. Its IUPAC name is (E)-N-[(Z)-2,8-dimethylnon-4-en-4-yl]oxy-2-methylpropan-1-imine.
| Compound Name | (E)-N-[(Z)-2,8-dimethylnon-4-en-4-yl]oxy-2-methylpropan-1-imine |
|---|---|
| PubChem CID | 145021226 |
| Molecular Formula | C15H29NO |
| Molecular Weight | 239.40 g/mol |
| Exact Mass | 239.22 |
| IUPAC Name | (E)-N-[(Z)-2,8-dimethylnon-4-en-4-yl]oxy-2-methylpropan-1-imine |
| SMILES | CC(C)/C=N/O/C(=C\CCC(C)C)CC(C)C |
| InChI | InChI=1S/C15H29NO/c1-12(2)8-7-9-15(10-13(3)4)17-16-11-14(5)6/h9,11-14H,7-8,10H2,1-6H3/b15-9-,16-11+ |
| InChIKey | BMDPWZTXEIBFTD-HEKJOVTRSA-N |
| XLogP | 5.01 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.40 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|