C15H21N3O3 — CID 145022818
N-[5-amino-4-methoxy-2-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]prop-2-enamide (PubChem CID 145022818) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[5-amino-4-methoxy-2-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]prop-2-enamide.
| Compound Name | N-[5-amino-4-methoxy-2-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 145022818 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | N-[5-amino-4-methoxy-2-[(3R)-1-methylpyrrolidin-3-yl]oxyphenyl]prop-2-enamide |
| SMILES | C=CC(=O)Nc1cc(N)c(OC)cc1O[C@@H]1CCN(C)C1 |
| InChI | InChI=1S/C15H21N3O3/c1-4-15(19)17-12-7-11(16)13(20-3)8-14(12)21-10-5-6-18(2)9-10/h4,7-8,10H,1,5-6,9,16H2,2-3H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | PJELDEDPHOVDIS-SNVBAGLBSA-N |
| XLogP | 1.48 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|