C16H14F4N4O — CID 145023084
N-[4-[(3-fluoroazetidin-2-yl)methyl]phenyl]-2-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 145023084) has the molecular formula C16H14F4N4O and a molecular weight of 354.31 g/mol. Its IUPAC name is N-[4-[(3-fluoroazetidin-2-yl)methyl]phenyl]-2-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | N-[4-[(3-fluoroazetidin-2-yl)methyl]phenyl]-2-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 145023084 |
| Molecular Formula | C16H14F4N4O |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | N-[4-[(3-fluoroazetidin-2-yl)methyl]phenyl]-2-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1ccc(CC2NCC2F)cc1)c1cnc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C16H14F4N4O/c17-12-8-21-13(12)5-9-1-3-11(4-2-9)24-14(25)10-6-22-15(23-7-10)16(18,19)20/h1-4,6-7,12-13,21H,5,8H2,(H,24,25) |
| InChIKey | ACKWAPUNQGIUMO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |