C14H11F4N3O — CID 136542110
N-(3-ethyl-4-fluorophenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide (PubChem CID 136542110) has the molecular formula C14H11F4N3O and a molecular weight of 313.25 g/mol. Its IUPAC name is N-(3-ethyl-4-fluorophenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide.
| Compound Name | N-(3-ethyl-4-fluorophenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 136542110 |
| Molecular Formula | C14H11F4N3O |
| Molecular Weight | 313.25 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | N-(3-ethyl-4-fluorophenyl)-2-(trifluoromethyl)pyrimidine-5-carboxamide |
| SMILES | CCc1cc(NC(=O)c2cnc(C(F)(F)F)nc2)ccc1F |
| InChI | InChI=1S/C14H11F4N3O/c1-2-8-5-10(3-4-11(8)15)21-12(22)9-6-19-13(20-7-9)14(16,17)18/h3-7H,2H2,1H3,(H,21,22) |
| InChIKey | FGRMORMUUVNWRR-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.25 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |