C16H16ClF3N4O — CID 109262564
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(diethylamino)pyrimidine-5-carboxamide (PubChem CID 109262564) has the molecular formula C16H16ClF3N4O and a molecular weight of 372.78 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(diethylamino)pyrimidine-5-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(diethylamino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109262564 |
| Molecular Formula | C16H16ClF3N4O |
| Molecular Weight | 372.78 g/mol |
| Exact Mass | 372.10 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(diethylamino)pyrimidine-5-carboxamide |
| SMILES | CCN(CC)c1ncc(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C16H16ClF3N4O/c1-3-24(4-2)15-21-8-10(9-22-15)14(25)23-11-5-6-13(17)12(7-11)16(18,19)20/h5-9H,3-4H2,1-2H3,(H,23,25) |
| InChIKey | LZRFVSGRKXVBEK-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.78 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |