C21H20O2 — CID 145023542
(E)-1-(5-ethoxycyclohexa-1,5-dien-1-yl)-3-naphthalen-2-ylprop-2-en-1-one (PubChem CID 145023542) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (E)-1-(5-ethoxycyclohexa-1,5-dien-1-yl)-3-naphthalen-2-ylprop-2-en-1-one.
| Compound Name | (E)-1-(5-ethoxycyclohexa-1,5-dien-1-yl)-3-naphthalen-2-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 145023542 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (E)-1-(5-ethoxycyclohexa-1,5-dien-1-yl)-3-naphthalen-2-ylprop-2-en-1-one |
| SMILES | CCOC1=CC(C(=O)/C=C/c2ccc3ccccc3c2)=CCC1 |
| InChI | InChI=1S/C21H20O2/c1-2-23-20-9-5-8-19(15-20)21(22)13-11-16-10-12-17-6-3-4-7-18(17)14-16/h3-4,6-8,10-15H,2,5,9H2,1H3/b13-11+ |
| InChIKey | LDIKPJLQZNZNKE-ACCUITESSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|