C19H20ClF3N4O2 — CID 145024850
N-(1-aminocyclopropyl)-2-[4-(4-chlorophenyl)-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetamide (PubChem CID 145024850) has the molecular formula C19H20ClF3N4O2 and a molecular weight of 428.84 g/mol. Its IUPAC name is N-(1-aminocyclopropyl)-2-[4-(4-chlorophenyl)-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetamide.
| Compound Name | N-(1-aminocyclopropyl)-2-[4-(4-chlorophenyl)-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetamide |
|---|---|
| PubChem CID | 145024850 |
| Molecular Formula | C19H20ClF3N4O2 |
| Molecular Weight | 428.84 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-(1-aminocyclopropyl)-2-[4-(4-chlorophenyl)-6-oxo-2-(4,4,4-trifluorobutyl)pyrimidin-1-yl]acetamide |
| SMILES | NC1(NC(=O)Cn2c(CCCC(F)(F)F)nc(-c3ccc(Cl)cc3)cc2=O)CC1 |
| InChI | InChI=1S/C19H20ClF3N4O2/c20-13-5-3-12(4-6-13)14-10-17(29)27(11-16(28)26-18(24)8-9-18)15(25-14)2-1-7-19(21,22)23/h3-6,10H,1-2,7-9,11,24H2,(H,26,28) |
| InChIKey | KMWIKUYFNJGRRB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.84 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|