C22H28ClN3O4 — CID 137426243
methyl 2-[[2-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]acetyl]amino]-2-methylpropanoate (PubChem CID 137426243) has the molecular formula C22H28ClN3O4 and a molecular weight of 433.94 g/mol. Its IUPAC name is methyl 2-[[2-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]acetyl]amino]-2-methylpropanoate.
| Compound Name | methyl 2-[[2-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]acetyl]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 137426243 |
| Molecular Formula | C22H28ClN3O4 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | methyl 2-[[2-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]acetyl]amino]-2-methylpropanoate |
| SMILES | CCCCCc1nc(-c2ccc(Cl)cc2)cc(=O)n1CC(=O)NC(C)(C)C(=O)OC |
| InChI | InChI=1S/C22H28ClN3O4/c1-5-6-7-8-18-24-17(15-9-11-16(23)12-10-15)13-20(28)26(18)14-19(27)25-22(2,3)21(29)30-4/h9-13H,5-8,14H2,1-4H3,(H,25,27) |
| InChIKey | QIGAAINAFAHAGJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|