C22H30ClN3O2 — CID 157437574
6-(4-chlorophenyl)-3-[5-(dimethylamino)-2-oxopentyl]-2-pentylpyrimidin-4-one (PubChem CID 157437574) has the molecular formula C22H30ClN3O2 and a molecular weight of 403.95 g/mol. Its IUPAC name is 6-(4-chlorophenyl)-3-[5-(dimethylamino)-2-oxopentyl]-2-pentylpyrimidin-4-one.
| Compound Name | 6-(4-chlorophenyl)-3-[5-(dimethylamino)-2-oxopentyl]-2-pentylpyrimidin-4-one |
|---|---|
| PubChem CID | 157437574 |
| Molecular Formula | C22H30ClN3O2 |
| Molecular Weight | 403.95 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | 6-(4-chlorophenyl)-3-[5-(dimethylamino)-2-oxopentyl]-2-pentylpyrimidin-4-one |
| SMILES | CCCCCc1nc(-c2ccc(Cl)cc2)cc(=O)n1CC(=O)CCCN(C)C |
| InChI | InChI=1S/C22H30ClN3O2/c1-4-5-6-9-21-24-20(17-10-12-18(23)13-11-17)15-22(28)26(21)16-19(27)8-7-14-25(2)3/h10-13,15H,4-9,14,16H2,1-3H3 |
| InChIKey | BRHBYJYRERTPIT-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.95 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|