C16H20ClN3O2 — CID 159052715
6-chloro-3-[3-(1-isocyanocyclopropyl)-2-oxopropyl]-2-pentylpyrimidin-4-one (PubChem CID 159052715) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is 6-chloro-3-[3-(1-isocyanocyclopropyl)-2-oxopropyl]-2-pentylpyrimidin-4-one.
| Compound Name | 6-chloro-3-[3-(1-isocyanocyclopropyl)-2-oxopropyl]-2-pentylpyrimidin-4-one |
|---|---|
| PubChem CID | 159052715 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 6-chloro-3-[3-(1-isocyanocyclopropyl)-2-oxopropyl]-2-pentylpyrimidin-4-one |
| SMILES | [C-]#[N+]C1(CC(=O)Cn2c(CCCCC)nc(Cl)cc2=O)CC1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-3-4-5-6-14-19-13(17)9-15(22)20(14)11-12(21)10-16(18-2)7-8-16/h9H,3-8,10-11H2,1H3 |
| InChIKey | DFFLMNRGQYJZCO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 56.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|