C23H30N4O3 — CID 159052716
4-[1-[3-(1-isocyanocyclopropyl)-2-oxopropyl]-6-oxo-2-pentylpyrimidin-4-yl]oxycyclohexane-1-carbonitrile (PubChem CID 159052716) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is 4-[1-[3-(1-isocyanocyclopropyl)-2-oxopropyl]-6-oxo-2-pentylpyrimidin-4-yl]oxycyclohexane-1-carbonitrile.
| Compound Name | 4-[1-[3-(1-isocyanocyclopropyl)-2-oxopropyl]-6-oxo-2-pentylpyrimidin-4-yl]oxycyclohexane-1-carbonitrile |
|---|---|
| PubChem CID | 159052716 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 4-[1-[3-(1-isocyanocyclopropyl)-2-oxopropyl]-6-oxo-2-pentylpyrimidin-4-yl]oxycyclohexane-1-carbonitrile |
| SMILES | [C-]#[N+]C1(CC(=O)Cn2c(CCCCC)nc(OC3CCC(C#N)CC3)cc2=O)CC1 |
| InChI | InChI=1S/C23H30N4O3/c1-3-4-5-6-20-26-21(30-19-9-7-17(15-24)8-10-19)13-22(29)27(20)16-18(28)14-23(25-2)11-12-23/h13,17,19H,3-12,14,16H2,1H3 |
| InChIKey | DVTZCZIIPUBRHD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 89.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|