C22H37NO2 — CID 57279431
3-[4-cyano-2-(1-pentylcyclohexyl)cyclohexyl]butanoic acid (PubChem CID 57279431) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is 3-[4-cyano-2-(1-pentylcyclohexyl)cyclohexyl]butanoic acid.
| Compound Name | 3-[4-cyano-2-(1-pentylcyclohexyl)cyclohexyl]butanoic acid |
|---|---|
| PubChem CID | 57279431 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | 3-[4-cyano-2-(1-pentylcyclohexyl)cyclohexyl]butanoic acid |
| SMILES | CCCCCC1(C2CC(C#N)CCC2C(C)CC(=O)O)CCCCC1 |
| InChI | InChI=1S/C22H37NO2/c1-3-4-6-11-22(12-7-5-8-13-22)20-15-18(16-23)9-10-19(20)17(2)14-21(24)25/h17-20H,3-15H2,1-2H3,(H,24,25) |
| InChIKey | IYHQLAMYCCPLAA-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|