C21H26ClN3O3 — CID 158117873
6-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]-5-oxohexanamide (PubChem CID 158117873) has the molecular formula C21H26ClN3O3 and a molecular weight of 403.91 g/mol. Its IUPAC name is 6-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]-5-oxohexanamide.
| Compound Name | 6-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]-5-oxohexanamide |
|---|---|
| PubChem CID | 158117873 |
| Molecular Formula | C21H26ClN3O3 |
| Molecular Weight | 403.91 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 6-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]-5-oxohexanamide |
| SMILES | CCCCCc1nc(-c2ccc(Cl)cc2)cc(=O)n1CC(=O)CCCC(N)=O |
| InChI | InChI=1S/C21H26ClN3O3/c1-2-3-4-8-20-24-18(15-9-11-16(22)12-10-15)13-21(28)25(20)14-17(26)6-5-7-19(23)27/h9-13H,2-8,14H2,1H3,(H2,23,27) |
| InChIKey | FRFXVGQLLSEUHU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.91 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|