C26H30ClN3O3 — CID 137426068
2-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]acetamide (PubChem CID 137426068) has the molecular formula C26H30ClN3O3 and a molecular weight of 468.00 g/mol. Its IUPAC name is 2-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]acetamide.
| Compound Name | 2-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]acetamide |
|---|---|
| PubChem CID | 137426068 |
| Molecular Formula | C26H30ClN3O3 |
| Molecular Weight | 468.00 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 2-[4-(4-chlorophenyl)-6-oxo-2-pentylpyrimidin-1-yl]-N-[(2R)-1-hydroxy-3-phenylpropan-2-yl]acetamide |
| SMILES | CCCCCc1nc(-c2ccc(Cl)cc2)cc(=O)n1CC(=O)N[C@@H](CO)Cc1ccccc1 |
| InChI | InChI=1S/C26H30ClN3O3/c1-2-3-5-10-24-29-23(20-11-13-21(27)14-12-20)16-26(33)30(24)17-25(32)28-22(18-31)15-19-8-6-4-7-9-19/h4,6-9,11-14,16,22,31H,2-3,5,10,15,17-18H2,1H3,(H,28,32)/t22-/m1/s1 |
| InChIKey | PZENGHBXHGAWFA-JOCHJYFZSA-N |
| XLogP | 4.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.00 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|