C20H18F3N7O — CID 145025471
4-[(3-amino-2-cyanoprop-2-enylidene)amino]-7-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide (PubChem CID 145025471) has the molecular formula C20H18F3N7O and a molecular weight of 429.41 g/mol. Its IUPAC name is 4-[(3-amino-2-cyanoprop-2-enylidene)amino]-7-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide.
| Compound Name | 4-[(3-amino-2-cyanoprop-2-enylidene)amino]-7-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide |
|---|---|
| PubChem CID | 145025471 |
| Molecular Formula | C20H18F3N7O |
| Molecular Weight | 429.41 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 4-[(3-amino-2-cyanoprop-2-enylidene)amino]-7-[[2-(trifluoromethyl)-4-pyridinyl]methyl]-6,8-dihydro-5H-1,7-naphthyridine-2-carboxamide |
| SMILES | N#CC(=CN)/C=N/c1cc(C(N)=O)nc2c1CCN(Cc1ccnc(C(F)(F)F)c1)C2 |
| InChI | InChI=1S/C20H18F3N7O/c21-20(22,23)18-5-12(1-3-27-18)10-30-4-2-14-15(28-9-13(7-24)8-25)6-16(19(26)31)29-17(14)11-30/h1,3,5-7,9H,2,4,10-11,24H2,(H2,26,31)/b13-7?,28-9+ |
| InChIKey | JVHYDXZXWVKHTP-VPJYFINXSA-N |
| XLogP | 2.22 |
| TPSA | 134.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|