About tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine
tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine (PubChem CID 145026020) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine.
Molecular Properties
| Compound Name | tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine |
| PubChem CID | 145026020 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine |
| SMILES | C/C=C(\C=N\C)CC.CC.CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C7H13N.C6H12O2.C2H6/c1-4-7(5-2)6-8-3;1-5(7)8-6(2,3)4;1-2/h4,6H,5H2,1-3H3;1-4H3;1-2H3/b7-4-,8-6+;; |
| InChIKey | PESBOWQRGYULQR-JGZVZBPVSA-N |
| XLogP | 4.42 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine?
The IUPAC name of tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine (CID 145026020) is tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine.
What is the SMILES notation for tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine?
The canonical SMILES for tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine is C/C=C(\C=N\C)CC.CC.CC(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine?
The InChIKey is PESBOWQRGYULQR-JGZVZBPVSA-N. The full InChI is InChI=1S/C7H13N.C6H12O2.C2H6/c1-4-7(5-2)6-8-3;1-5(7)8-6(2,3)4;1-2/h4,6H,5H2,1-3H3;1-4H3;1-2H3/b7-4-,8-6+;;.
What are the key properties of tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine?
tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine has a molecular weight of 257.42 g/mol, XLogP of 4.42, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl acetate;ethane;(Z)-2-ethyl-N-methylbut-2-en-1-imine is sourced from PubChem (CID 145026020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).