C18H20O2 — CID 145027627
[4-(cyclohepta-1,3,4,6-tetraen-1-ylmethyl)phenyl] acetate;ethane (PubChem CID 145027627) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is [4-(cyclohepta-1,3,4,6-tetraen-1-ylmethyl)phenyl] acetate;ethane.
| Compound Name | [4-(cyclohepta-1,3,4,6-tetraen-1-ylmethyl)phenyl] acetate;ethane |
|---|---|
| PubChem CID | 145027627 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | [4-(cyclohepta-1,3,4,6-tetraen-1-ylmethyl)phenyl] acetate;ethane |
| SMILES | CC.CC(=O)Oc1ccc(CC2=CC=C=CC=C2)cc1 |
| InChI | InChI=1S/C16H14O2.C2H6/c1-13(17)18-16-10-8-15(9-11-16)12-14-6-4-2-3-5-7-14;1-2/h2,4-11H,12H2,1H3;1-2H3 |
| InChIKey | CXLWZPCOIFYCDG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|