C21H37N3O — CID 145029221
(Z)-but-2-ene;4-[1-(dimethylamino)-2-(methylamino)ethyl]benzaldehyde;1-methylpyrrolidine (PubChem CID 145029221) has the molecular formula C21H37N3O and a molecular weight of 347.55 g/mol. Its IUPAC name is (Z)-but-2-ene;4-[1-(dimethylamino)-2-(methylamino)ethyl]benzaldehyde;1-methylpyrrolidine.
| Compound Name | (Z)-but-2-ene;4-[1-(dimethylamino)-2-(methylamino)ethyl]benzaldehyde;1-methylpyrrolidine |
|---|---|
| PubChem CID | 145029221 |
| Molecular Formula | C21H37N3O |
| Molecular Weight | 347.55 g/mol |
| Exact Mass | 347.29 |
| IUPAC Name | (Z)-but-2-ene;4-[1-(dimethylamino)-2-(methylamino)ethyl]benzaldehyde;1-methylpyrrolidine |
| SMILES | C/C=C\C.CN1CCCC1.CNCC(c1ccc(C=O)cc1)N(C)C |
| InChI | InChI=1S/C12H18N2O.C5H11N.C4H8/c1-13-8-12(14(2)3)11-6-4-10(9-15)5-7-11;1-6-4-2-3-5-6;1-3-4-2/h4-7,9,12-13H,8H2,1-3H3;2-5H2,1H3;3-4H,1-2H3/b;;4-3- |
| InChIKey | WCBIWVIMNUXAMC-PWIAZYAQSA-N |
| XLogP | 3.62 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.55 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|