C17H22N2O2S — CID 145029124
1-[4-(benzenesulfonyl)phenyl]-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 145029124) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is 1-[4-(benzenesulfonyl)phenyl]-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | 1-[4-(benzenesulfonyl)phenyl]-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 145029124 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-[4-(benzenesulfonyl)phenyl]-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CNCC(c1ccc(S(=O)(=O)c2ccccc2)cc1)N(C)C |
| InChI | InChI=1S/C17H22N2O2S/c1-18-13-17(19(2)3)14-9-11-16(12-10-14)22(20,21)15-7-5-4-6-8-15/h4-12,17-18H,13H2,1-3H3 |
| InChIKey | SYXQRNFYPPQITN-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |