C22H22F2N2O2 — CID 145029884
N-[(E)-but-2-enyl]-3-(3,5-difluorophenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide (PubChem CID 145029884) has the molecular formula C22H22F2N2O2 and a molecular weight of 384.43 g/mol. Its IUPAC name is N-[(E)-but-2-enyl]-3-(3,5-difluorophenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide.
| Compound Name | N-[(E)-but-2-enyl]-3-(3,5-difluorophenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 145029884 |
| Molecular Formula | C22H22F2N2O2 |
| Molecular Weight | 384.43 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | N-[(E)-but-2-enyl]-3-(3,5-difluorophenyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
| SMILES | C/C=C/CNC(=O)C(Cc1cc(F)cc(F)c1)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H22F2N2O2/c1-2-3-11-25-22(28)20(14-17-12-18(23)15-19(24)13-17)26-21(27)10-9-16-7-5-4-6-8-16/h2-10,12-13,15,20H,11,14H2,1H3,(H,25,28)(H,26,27)/b3-2+,10-9+ |
| InChIKey | UNWDLYDSJAKLKD-SCIPBJTFSA-N |
| XLogP | 3.40 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.43 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|