C26H21FN4O2S — CID 3658758
N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-phenyl-2-(3-phenylprop-2-enoylamino)propanamide (PubChem CID 3658758) has the molecular formula C26H21FN4O2S and a molecular weight of 472.55 g/mol. Its IUPAC name is N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-phenyl-2-(3-phenylprop-2-enoylamino)propanamide.
| Compound Name | N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-phenyl-2-(3-phenylprop-2-enoylamino)propanamide |
|---|---|
| PubChem CID | 3658758 |
| Molecular Formula | C26H21FN4O2S |
| Molecular Weight | 472.55 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | N-[5-(4-fluorophenyl)-1,3,4-thiadiazol-2-yl]-3-phenyl-2-(3-phenylprop-2-enoylamino)propanamide |
| SMILES | O=C(C=Cc1ccccc1)NC(Cc1ccccc1)C(=O)Nc1nnc(-c2ccc(F)cc2)s1 |
| InChI | InChI=1S/C26H21FN4O2S/c27-21-14-12-20(13-15-21)25-30-31-26(34-25)29-24(33)22(17-19-9-5-2-6-10-19)28-23(32)16-11-18-7-3-1-4-8-18/h1-16,22H,17H2,(H,28,32)(H,29,31,33) |
| InChIKey | VENYWFQYOVVQQJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|