C23H23ClN4O2S — CID 92516940
(2S,3R)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]pentanamide (PubChem CID 92516940) has the molecular formula C23H23ClN4O2S and a molecular weight of 454.98 g/mol. Its IUPAC name is (2S,3R)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]pentanamide.
| Compound Name | (2S,3R)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]pentanamide |
|---|---|
| PubChem CID | 92516940 |
| Molecular Formula | C23H23ClN4O2S |
| Molecular Weight | 454.98 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (2S,3R)-N-[5-(4-chlorophenyl)-1,3,4-thiadiazol-2-yl]-3-methyl-2-[[(E)-3-phenylprop-2-enoyl]amino]pentanamide |
| SMILES | CC[C@@H](C)[C@H](NC(=O)/C=C/c1ccccc1)C(=O)Nc1nnc(-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C23H23ClN4O2S/c1-3-15(2)20(25-19(29)14-9-16-7-5-4-6-8-16)21(30)26-23-28-27-22(31-23)17-10-12-18(24)13-11-17/h4-15,20H,3H2,1-2H3,(H,25,29)(H,26,28,30)/b14-9+/t15-,20+/m1/s1 |
| InChIKey | XLASNNUSMFGVGL-SGLMEMEBSA-N |
| XLogP | 5.04 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.98 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|