C23H24N4O2S — CID 7495405
(2R)-3-methyl-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]butanamide (PubChem CID 7495405) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is (2R)-3-methyl-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]butanamide.
| Compound Name | (2R)-3-methyl-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]butanamide |
|---|---|
| PubChem CID | 7495405 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | (2R)-3-methyl-N-[5-(3-methylphenyl)-1,3,4-thiadiazol-2-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]butanamide |
| SMILES | Cc1cccc(-c2nnc(NC(=O)[C@H](NC(=O)/C=C/c3ccccc3)C(C)C)s2)c1 |
| InChI | InChI=1S/C23H24N4O2S/c1-15(2)20(24-19(28)13-12-17-9-5-4-6-10-17)21(29)25-23-27-26-22(30-23)18-11-7-8-16(3)14-18/h4-15,20H,1-3H3,(H,24,28)(H,25,27,29)/b13-12+/t20-/m1/s1 |
| InChIKey | KNHJQOMEEIJAPA-DRUFCSCSSA-N |
| XLogP | 4.31 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|