C19H29F2N3O2 — CID 145029923
4-(3,5-difluorophenyl)-2-(6-methylheptylcarbamoylamino)butanamide (PubChem CID 145029923) has the molecular formula C19H29F2N3O2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 4-(3,5-difluorophenyl)-2-(6-methylheptylcarbamoylamino)butanamide.
| Compound Name | 4-(3,5-difluorophenyl)-2-(6-methylheptylcarbamoylamino)butanamide |
|---|---|
| PubChem CID | 145029923 |
| Molecular Formula | C19H29F2N3O2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 4-(3,5-difluorophenyl)-2-(6-methylheptylcarbamoylamino)butanamide |
| SMILES | CC(C)CCCCCNC(=O)NC(CCc1cc(F)cc(F)c1)C(N)=O |
| InChI | InChI=1S/C19H29F2N3O2/c1-13(2)6-4-3-5-9-23-19(26)24-17(18(22)25)8-7-14-10-15(20)12-16(21)11-14/h10-13,17H,3-9H2,1-2H3,(H2,22,25)(H2,23,24,26) |
| InChIKey | SHNYDRIKPBECGS-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|