C24H30N4O3 — CID 145030639
butyl (2S,4R)-1-acetyl-4-[[5-(aziridin-2-yl)-2-pyridinyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-6-carboxylate (PubChem CID 145030639) has the molecular formula C24H30N4O3 and a molecular weight of 422.53 g/mol. Its IUPAC name is butyl (2S,4R)-1-acetyl-4-[[5-(aziridin-2-yl)-2-pyridinyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-6-carboxylate.
| Compound Name | butyl (2S,4R)-1-acetyl-4-[[5-(aziridin-2-yl)-2-pyridinyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 145030639 |
| Molecular Formula | C24H30N4O3 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | butyl (2S,4R)-1-acetyl-4-[[5-(aziridin-2-yl)-2-pyridinyl]amino]-2-methyl-3,4-dihydro-2H-quinoline-6-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2c(c1)[C@H](Nc1ccc(C3CN3)cn1)C[C@H](C)N2C(C)=O |
| InChI | InChI=1S/C24H30N4O3/c1-4-5-10-31-24(30)17-6-8-22-19(12-17)20(11-15(2)28(22)16(3)29)27-23-9-7-18(13-26-23)21-14-25-21/h6-9,12-13,15,20-21,25H,4-5,10-11,14H2,1-3H3,(H,26,27)/t15-,20+,21?/m0/s1 |
| InChIKey | CVGUYWVQRCBDAW-XDJLXXALSA-N |
| XLogP | 3.98 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|