C35H34Cl2N4O3 — CID 145032444
4-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]benzoic acid;ethanol (PubChem CID 145032444) has the molecular formula C35H34Cl2N4O3 and a molecular weight of 629.59 g/mol. Its IUPAC name is 4-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]benzoic acid;ethanol.
| Compound Name | 4-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]benzoic acid;ethanol |
|---|---|
| PubChem CID | 145032444 |
| Molecular Formula | C35H34Cl2N4O3 |
| Molecular Weight | 629.59 g/mol |
| Exact Mass | 628.20 |
| IUPAC Name | 4-[4-[[6-[bis(4-chlorophenyl)methyl]quinazolin-4-yl]amino]piperidin-1-yl]benzoic acid;ethanol |
| SMILES | CCO.O=C(O)c1ccc(N2CCC(Nc3ncnc4ccc(C(c5ccc(Cl)cc5)c5ccc(Cl)cc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C33H28Cl2N4O2.C2H6O/c34-25-8-1-21(2-9-25)31(22-3-10-26(35)11-4-22)24-7-14-30-29(19-24)32(37-20-36-30)38-27-15-17-39(18-16-27)28-12-5-23(6-13-28)33(40)41;1-2-3/h1-14,19-20,27,31H,15-18H2,(H,40,41)(H,36,37,38);3H,2H2,1H3 |
| InChIKey | BTFLURFESNMUFD-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.59 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|