C20H22N4O — CID 145032499
[(1S)-1-[1-(3-methylphenyl)imidazol-2-yl]-3-phenylpropyl]urea (PubChem CID 145032499) has the molecular formula C20H22N4O and a molecular weight of 334.42 g/mol. Its IUPAC name is [(1S)-1-[1-(3-methylphenyl)imidazol-2-yl]-3-phenylpropyl]urea.
| Compound Name | [(1S)-1-[1-(3-methylphenyl)imidazol-2-yl]-3-phenylpropyl]urea |
|---|---|
| PubChem CID | 145032499 |
| Molecular Formula | C20H22N4O |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [(1S)-1-[1-(3-methylphenyl)imidazol-2-yl]-3-phenylpropyl]urea |
| SMILES | Cc1cccc(-n2ccnc2[C@H](CCc2ccccc2)NC(N)=O)c1 |
| InChI | InChI=1S/C20H22N4O/c1-15-6-5-9-17(14-15)24-13-12-22-19(24)18(23-20(21)25)11-10-16-7-3-2-4-8-16/h2-9,12-14,18H,10-11H2,1H3,(H3,21,23,25)/t18-/m0/s1 |
| InChIKey | XLGUNZQADYIPQP-SFHVURJKSA-N |
| XLogP | 3.52 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |