C25H23N5O5S — CID 118951002
1-(2-methylphenyl)sulfonyl-3-[(1S)-1-[1-(4-nitrophenyl)imidazol-2-yl]-2-phenylethyl]urea (PubChem CID 118951002) has the molecular formula C25H23N5O5S and a molecular weight of 505.56 g/mol. Its IUPAC name is 1-(2-methylphenyl)sulfonyl-3-[(1S)-1-[1-(4-nitrophenyl)imidazol-2-yl]-2-phenylethyl]urea.
| Compound Name | 1-(2-methylphenyl)sulfonyl-3-[(1S)-1-[1-(4-nitrophenyl)imidazol-2-yl]-2-phenylethyl]urea |
|---|---|
| PubChem CID | 118951002 |
| Molecular Formula | C25H23N5O5S |
| Molecular Weight | 505.56 g/mol |
| Exact Mass | 505.14 |
| IUPAC Name | 1-(2-methylphenyl)sulfonyl-3-[(1S)-1-[1-(4-nitrophenyl)imidazol-2-yl]-2-phenylethyl]urea |
| SMILES | Cc1ccccc1S(=O)(=O)NC(=O)N[C@@H](Cc1ccccc1)c1nccn1-c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H23N5O5S/c1-18-7-5-6-10-23(18)36(34,35)28-25(31)27-22(17-19-8-3-2-4-9-19)24-26-15-16-29(24)20-11-13-21(14-12-20)30(32)33/h2-16,22H,17H2,1H3,(H2,27,28,31)/t22-/m0/s1 |
| InChIKey | PAVWNWKXQWLZJM-QFIPXVFZSA-N |
| XLogP | 4.06 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.56 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|