C26H26N4O3S — CID 145032611
1-[1-[1-(2-methoxyphenyl)imidazol-2-yl]-2-phenylethyl]-3-(2-methylphenyl)sulfinylurea (PubChem CID 145032611) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is 1-[1-[1-(2-methoxyphenyl)imidazol-2-yl]-2-phenylethyl]-3-(2-methylphenyl)sulfinylurea.
| Compound Name | 1-[1-[1-(2-methoxyphenyl)imidazol-2-yl]-2-phenylethyl]-3-(2-methylphenyl)sulfinylurea |
|---|---|
| PubChem CID | 145032611 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 1-[1-[1-(2-methoxyphenyl)imidazol-2-yl]-2-phenylethyl]-3-(2-methylphenyl)sulfinylurea |
| SMILES | COc1ccccc1-n1ccnc1C(Cc1ccccc1)NC(=O)NS(=O)c1ccccc1C |
| InChI | InChI=1S/C26H26N4O3S/c1-19-10-6-9-15-24(19)34(32)29-26(31)28-21(18-20-11-4-3-5-12-20)25-27-16-17-30(25)22-13-7-8-14-23(22)33-2/h3-17,21H,18H2,1-2H3,(H2,28,29,31) |
| InChIKey | OOMOQDBUTALFGU-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |