C29H31N5 — CID 145036482
(3E,5E)-5-[3-[4-[(1Z)-1-cyclopenta-1,4-dien-1-ylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-indazol-5-yl]-N,N-dimethylhepta-1,3,5-trien-3-amine (PubChem CID 145036482) has the molecular formula C29H31N5 and a molecular weight of 449.60 g/mol. Its IUPAC name is (3E,5E)-5-[3-[4-[(1Z)-1-cyclopenta-1,4-dien-1-ylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-indazol-5-yl]-N,N-dimethylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-[3-[4-[(1Z)-1-cyclopenta-1,4-dien-1-ylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-indazol-5-yl]-N,N-dimethylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145036482 |
| Molecular Formula | C29H31N5 |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.26 |
| IUPAC Name | (3E,5E)-5-[3-[4-[(1Z)-1-cyclopenta-1,4-dien-1-ylbuta-1,3-dienyl]-5-methyl-1H-imidazol-2-yl]-1H-indazol-5-yl]-N,N-dimethylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(/C1=CCC=C1)c1nc(-c2n[nH]c3ccc(C(=C/C)/C=C(\C=C)N(C)C)cc23)[nH]c1C |
| InChI | InChI=1S/C29H31N5/c1-7-12-24(21-13-10-11-14-21)27-19(4)30-29(31-27)28-25-18-22(15-16-26(25)32-33-28)20(8-2)17-23(9-3)34(5)6/h7-10,12-18H,1,3,11H2,2,4-6H3,(H,30,31)(H,32,33)/b20-8+,23-17+,24-12- |
| InChIKey | AZKOAGBMQNRFND-PDRACSALSA-N |
| XLogP | 6.75 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|