C34H49N7 — CID 145036599
ethane;(4Z,6E)-4-ethenyl-N,N-dimethyl-6-[3-[5-methyl-4-[(1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-indazol-5-yl]octa-4,6-dien-1-amine (PubChem CID 145036599) has the molecular formula C34H49N7 and a molecular weight of 555.82 g/mol. Its IUPAC name is ethane;(4Z,6E)-4-ethenyl-N,N-dimethyl-6-[3-[5-methyl-4-[(1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-indazol-5-yl]octa-4,6-dien-1-amine.
| Compound Name | ethane;(4Z,6E)-4-ethenyl-N,N-dimethyl-6-[3-[5-methyl-4-[(1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-indazol-5-yl]octa-4,6-dien-1-amine |
|---|---|
| PubChem CID | 145036599 |
| Molecular Formula | C34H49N7 |
| Molecular Weight | 555.82 g/mol |
| Exact Mass | 555.40 |
| IUPAC Name | ethane;(4Z,6E)-4-ethenyl-N,N-dimethyl-6-[3-[5-methyl-4-[(1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-indazol-5-yl]octa-4,6-dien-1-amine |
| SMILES | C=C/C=C(\c1nc(-c2n[nH]c3ccc(C(/C=C(\C=C)CCCN(C)C)=C/C)cc23)[nH]c1C)N1CCN(C)CC1.CC |
| InChI | InChI=1S/C32H43N7.C2H6/c1-8-12-29(39-19-17-38(7)18-20-39)30-23(4)33-32(34-30)31-27-22-26(14-15-28(27)35-36-31)25(10-3)21-24(9-2)13-11-16-37(5)6;1-2/h8-10,12,14-15,21-22H,1-2,11,13,16-20H2,3-7H3,(H,33,34)(H,35,36);1-2H3/b24-21+,25-10+,29-12+; |
| InChIKey | QLIOKKLHRDMQBA-QMTFOQPNSA-N |
| XLogP | 6.92 |
| TPSA | 67.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.82 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|