C32H41N7 — CID 145037902
(3E,5E)-5-[3-[5-methyl-4-[(1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine (PubChem CID 145037902) has the molecular formula C32H41N7 and a molecular weight of 523.73 g/mol. Its IUPAC name is (3E,5E)-5-[3-[5-methyl-4-[(1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-[3-[5-methyl-4-[(1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145037902 |
| Molecular Formula | C32H41N7 |
| Molecular Weight | 523.73 g/mol |
| Exact Mass | 523.34 |
| IUPAC Name | (3E,5E)-5-[3-[5-methyl-4-[(1E)-1-(4-methylpiperazin-1-yl)buta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrrolo[2,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(\c1nc(-c2c[nH]c3ncc(C(/C=C(\C=C)NC(=C)CCC)=C/C)cc23)[nH]c1C)N1CCN(C)CC1 |
| InChI | InChI=1S/C32H41N7/c1-8-12-22(5)35-26(11-4)18-24(10-3)25-19-27-28(21-34-31(27)33-20-25)32-36-23(6)30(37-32)29(13-9-2)39-16-14-38(7)15-17-39/h9-11,13,18-21,35H,2,4-5,8,12,14-17H2,1,3,6-7H3,(H,33,34)(H,36,37)/b24-10+,26-18+,29-13+ |
| InChIKey | IVHZMAKHZKAINN-YUDUREMMSA-N |
| XLogP | 6.41 |
| TPSA | 75.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.73 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|