C31H33N7 — CID 145253506
(3E,5E)-5-[3-[5-methyl-4-[(1Z)-1-pyridin-3-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine (PubChem CID 145253506) has the molecular formula C31H33N7 and a molecular weight of 503.65 g/mol. Its IUPAC name is (3E,5E)-5-[3-[5-methyl-4-[(1Z)-1-pyridin-3-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-[3-[5-methyl-4-[(1Z)-1-pyridin-3-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145253506 |
| Molecular Formula | C31H33N7 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | (3E,5E)-5-[3-[5-methyl-4-[(1Z)-1-pyridin-3-ylbuta-1,3-dienyl]-1H-imidazol-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C=C(/c1cccnc1)c1nc(-c2n[nH]c3ccc(C(/C=C(\C=C)NC(=C)CCC)=C/C)nc23)[nH]c1C |
| InChI | InChI=1S/C31H33N7/c1-7-12-20(5)33-24(10-4)18-22(9-3)26-15-16-27-29(35-26)30(38-37-27)31-34-21(6)28(36-31)25(13-8-2)23-14-11-17-32-19-23/h8-11,13-19,33H,2,4-5,7,12H2,1,3,6H3,(H,34,36)(H,37,38)/b22-9+,24-18+,25-13- |
| InChIKey | YYYFELSOZNFJNS-HLHFDDSGSA-N |
| XLogP | 7.05 |
| TPSA | 95.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|