C30H30N6S — CID 145254449
(3E,5E)-5-[3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine (PubChem CID 145254449) has the molecular formula C30H30N6S and a molecular weight of 506.68 g/mol. Its IUPAC name is (3E,5E)-5-[3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine.
| Compound Name | (3E,5E)-5-[3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine |
|---|---|
| PubChem CID | 145254449 |
| Molecular Formula | C30H30N6S |
| Molecular Weight | 506.68 g/mol |
| Exact Mass | 506.23 |
| IUPAC Name | (3E,5E)-5-[3-[4-(5-methylthiophen-2-yl)-1H-pyrrolo[2,3-c]pyridin-2-yl]-1H-pyrazolo[4,3-b]pyridin-5-yl]-N-pent-1-en-2-ylhepta-1,3,5-trien-3-amine |
| SMILES | C=C/C(=C\C(=C/C)c1ccc2[nH]nc(-c3cc4c(-c5ccc(C)s5)cncc4[nH]3)c2n1)NC(=C)CCC |
| InChI | InChI=1S/C30H30N6S/c1-6-9-18(4)32-21(8-3)14-20(7-2)24-11-12-25-29(34-24)30(36-35-25)26-15-22-23(16-31-17-27(22)33-26)28-13-10-19(5)37-28/h7-8,10-17,32-33H,3-4,6,9H2,1-2,5H3,(H,35,36)/b20-7+,21-14+ |
| InChIKey | GFRVFQIQEOANGI-PCXLMVEFSA-N |
| XLogP | 7.91 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.68 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|